C15H25ClN2OSi — CID 156753397
tert-butyl-[1-(2-chloro-6-methyl-4-pyridinyl)azetidin-3-yl]oxy-dimethylsilane (PubChem CID 156753397) has the molecular formula C15H25ClN2OSi and a molecular weight of 312.92 g/mol. Its IUPAC name is tert-butyl-[1-(2-chloro-6-methyl-4-pyridinyl)azetidin-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-(2-chloro-6-methyl-4-pyridinyl)azetidin-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 156753397 |
| Molecular Formula | C15H25ClN2OSi |
| Molecular Weight | 312.92 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | tert-butyl-[1-(2-chloro-6-methyl-4-pyridinyl)azetidin-3-yl]oxy-dimethylsilane |
| SMILES | Cc1cc(N2CC(O[Si](C)(C)C(C)(C)C)C2)cc(Cl)n1 |
| InChI | InChI=1S/C15H25ClN2OSi/c1-11-7-12(8-14(16)17-11)18-9-13(10-18)19-20(5,6)15(2,3)4/h7-8,13H,9-10H2,1-6H3 |
| InChIKey | FRMKXMMKCFABEV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.92 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|