C19H25N7S — CID 70660401
N-[(1R,5S)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-propyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 70660401) has the molecular formula C19H25N7S and a molecular weight of 383.53 g/mol. Its IUPAC name is N-[(1R,5S)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-propyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1R,5S)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-propyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 70660401 |
| Molecular Formula | C19H25N7S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | N-[(1R,5S)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-propyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CCCc1cccc2nc(NC3[C@@H]4CC[C@H]3CN(c3nc(C)ns3)C4)nn12 |
| InChI | InChI=1S/C19H25N7S/c1-3-5-15-6-4-7-16-21-18(23-26(15)16)22-17-13-8-9-14(17)11-25(10-13)19-20-12(2)24-27-19/h4,6-7,13-14,17H,3,5,8-11H2,1-2H3,(H,22,23)/t13-,14+,17? |
| InChIKey | OXXWXNARYGPFDN-VMZNBEPHSA-N |
| XLogP | 3.17 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |