C25H24F3N5OS — CID 147277792
3-methyl-5-[(1R,5S)-8-[[8-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole (PubChem CID 147277792) has the molecular formula C25H24F3N5OS and a molecular weight of 499.56 g/mol. Its IUPAC name is 3-methyl-5-[(1R,5S)-8-[[8-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole.
| Compound Name | 3-methyl-5-[(1R,5S)-8-[[8-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole |
|---|---|
| PubChem CID | 147277792 |
| Molecular Formula | C25H24F3N5OS |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 3-methyl-5-[(1R,5S)-8-[[8-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Cc2nc3c(-c4ccc(OC(F)(F)F)cc4)cccn3n2)sn1 |
| InChI | InChI=1S/C25H24F3N5OS/c1-15-11-23(35-31-15)32-13-17-4-5-18(14-32)21(17)12-22-29-24-20(3-2-10-33(24)30-22)16-6-8-19(9-7-16)34-25(26,27)28/h2-3,6-11,17-18,21H,4-5,12-14H2,1H3/t17-,18+,21? |
| InChIKey | CRRWUCVJYGGJQV-HTZLVSCSSA-N |
| XLogP | 5.76 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |