C23H19F3N6S — CID 126692870
3-methyl-5-[(5S,6S)-7-[8-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonan-3-yl]-1,2-thiazole (PubChem CID 126692870) has the molecular formula C23H19F3N6S and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-methyl-5-[(5S,6S)-7-[8-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonan-3-yl]-1,2-thiazole.
| Compound Name | 3-methyl-5-[(5S,6S)-7-[8-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonan-3-yl]-1,2-thiazole |
|---|---|
| PubChem CID | 126692870 |
| Molecular Formula | C23H19F3N6S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-methyl-5-[(5S,6S)-7-[8-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonan-3-yl]-1,2-thiazole |
| SMILES | Cc1cc(N2C[C@@H]3CCC4(C2)[C@H]3N4c2nc3c(-c4cc(F)c(F)c(F)c4)cccn3n2)sn1 |
| InChI | InChI=1S/C23H19F3N6S/c1-12-7-18(33-29-12)30-10-13-4-5-23(11-30)20(13)32(23)22-27-21-15(3-2-6-31(21)28-22)14-8-16(24)19(26)17(25)9-14/h2-3,6-9,13,20H,4-5,10-11H2,1H3/t13-,20-,23?,32?/m0/s1 |
| InChIKey | VKOIZWCUDJLRIZ-ZYXXAFQVSA-N |
| XLogP | 4.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|