About 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole
5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole (PubChem CID 58398282) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole.
Molecular Properties
| Compound Name | 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole |
| PubChem CID | 58398282 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole |
| SMILES | CC(C)(C)C(C)(C)C1=CCC=N1 |
| InChI | InChI=1S/C11H19N/c1-10(2,3)11(4,5)9-7-6-8-12-9/h7-8H,6H2,1-5H3 |
| InChIKey | ICVWRGAVOMPQSV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole?
The IUPAC name of 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole (CID 58398282) is 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole.
What is the SMILES notation for 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole?
The canonical SMILES for 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole is CC(C)(C)C(C)(C)C1=CCC=N1.
What is the InChIKey of 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole?
The InChIKey is ICVWRGAVOMPQSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-10(2,3)11(4,5)9-7-6-8-12-9/h7-8H,6H2,1-5H3.
What are the key properties of 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole?
5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole has a molecular weight of 165.28 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3,3-trimethylbutan-2-yl)-3H-pyrrole is sourced from PubChem (CID 58398282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).