C15H24FN — CID 166755575
(2R,3E)-2-ethyl-N-(4-fluoropent-1-en-2-yl)-2-methylhepta-3,6-dien-1-imine (PubChem CID 166755575) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is (2R,3E)-2-ethyl-N-(4-fluoropent-1-en-2-yl)-2-methylhepta-3,6-dien-1-imine.
| Compound Name | (2R,3E)-2-ethyl-N-(4-fluoropent-1-en-2-yl)-2-methylhepta-3,6-dien-1-imine |
|---|---|
| PubChem CID | 166755575 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | (2R,3E)-2-ethyl-N-(4-fluoropent-1-en-2-yl)-2-methylhepta-3,6-dien-1-imine |
| SMILES | C=CC/C=C/[C@](C)(/C=N/C(=C)CC(C)F)CC |
| InChI | InChI=1S/C15H24FN/c1-6-8-9-10-15(5,7-2)12-17-14(4)11-13(3)16/h6,9-10,12-13H,1,4,7-8,11H2,2-3,5H3/b10-9+,17-12+/t13?,15-/m1/s1 |
| InChIKey | RXQUCAQFEZNONK-GXNJLAJQSA-N |
| XLogP | 4.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|