About methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide
methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide (PubChem CID 58399761) has the molecular formula C8H12N2-2
and a molecular weight of 136.20 g/mol. Its IUPAC name is methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide.
Molecular Properties
| Compound Name | methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide |
| PubChem CID | 58399761 |
| Molecular Formula | C8H12N2-2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide |
| SMILES | C[N-]C1=CCC(C)=C1[N-]C |
| InChI | InChI=1S/C8H12N2/c1-6-4-5-7(9-2)8(6)10-3/h5H,4H2,1-3H3/q-2 |
| InChIKey | RGFLBQNENQPOMV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide?
The IUPAC name of methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide (CID 58399761) is methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide.
What is the SMILES notation for methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide?
The canonical SMILES for methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide is C[N-]C1=CCC(C)=C1[N-]C.
What is the InChIKey of methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide?
The InChIKey is RGFLBQNENQPOMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-4-5-7(9-2)8(6)10-3/h5H,4H2,1-3H3/q-2.
What are the key properties of methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide?
methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide has a molecular weight of 136.20 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(2-methyl-5-methylazanidylcyclopenta-1,4-dien-1-yl)azanide is sourced from PubChem (CID 58399761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).