C11H21N3 — CID 87388747
1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine (PubChem CID 87388747) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine.
| Compound Name | 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine |
|---|---|
| PubChem CID | 87388747 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine |
| SMILES | CN(C)C1=CCC(N(C)C)=C1N(C)C |
| InChI | InChI=1S/C11H21N3/c1-12(2)9-7-8-10(13(3)4)11(9)14(5)6/h7H,8H2,1-6H3 |
| InChIKey | MUZPBPOJZRJWGH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |