C12H18N2 — CID 142992167
(4E,7Z)-1-N,1-N,5-N,5-N-tetramethylcycloocta-1,2,4,7-tetraene-1,5-diamine (PubChem CID 142992167) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (4E,7Z)-1-N,1-N,5-N,5-N-tetramethylcycloocta-1,2,4,7-tetraene-1,5-diamine.
| Compound Name | (4E,7Z)-1-N,1-N,5-N,5-N-tetramethylcycloocta-1,2,4,7-tetraene-1,5-diamine |
|---|---|
| PubChem CID | 142992167 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (4E,7Z)-1-N,1-N,5-N,5-N-tetramethylcycloocta-1,2,4,7-tetraene-1,5-diamine |
| SMILES | CN(C)C1=C=C/C=C(/N(C)C)C/C=C\1 |
| InChI | InChI=1S/C12H18N2/c1-13(2)11-7-5-9-12(14(3)4)10-6-8-11/h5-7,10H,8H2,1-4H3/b10-6-,11-7+ |
| InChIKey | QNTVFYNPWBFYSI-NAKBGQTNSA-N |
| XLogP | 1.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |