C9H18O2 — CID 58400213
[(3R,4R)-3,4,5-trimethyloxan-2-yl]methanol (PubChem CID 58400213) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is [(3R,4R)-3,4,5-trimethyloxan-2-yl]methanol.
| Compound Name | [(3R,4R)-3,4,5-trimethyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 58400213 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | [(3R,4R)-3,4,5-trimethyloxan-2-yl]methanol |
| SMILES | CC1COC(CO)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C9H18O2/c1-6-5-11-9(4-10)8(3)7(6)2/h6-10H,4-5H2,1-3H3/t6?,7-,8-,9?/m1/s1 |
| InChIKey | GSQWEOAPSNJBAJ-OMRMXDSLSA-N |
| XLogP | 1.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |