C14H15FO3 — CID 58400519
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-fluoro-2H-chromene (PubChem CID 58400519) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-fluoro-2H-chromene.
| Compound Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-fluoro-2H-chromene |
|---|---|
| PubChem CID | 58400519 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-fluoro-2H-chromene |
| SMILES | CC1(C)OC[C@@H](C2C=Cc3cc(F)ccc3O2)O1 |
| InChI | InChI=1S/C14H15FO3/c1-14(2)16-8-13(18-14)12-5-3-9-7-10(15)4-6-11(9)17-12/h3-7,12-13H,8H2,1-2H3/t12?,13-/m0/s1 |
| InChIKey | PYGMAHPTXWUIAI-ABLWVSNPSA-N |
| XLogP | 2.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |