C11H15BrO4 — CID 71050942
5-bromo-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2H-pyran-6-one (PubChem CID 71050942) has the molecular formula C11H15BrO4 and a molecular weight of 291.14 g/mol. Its IUPAC name is 5-bromo-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2H-pyran-6-one.
| Compound Name | 5-bromo-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2H-pyran-6-one |
|---|---|
| PubChem CID | 71050942 |
| Molecular Formula | C11H15BrO4 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 5-bromo-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyl-2H-pyran-6-one |
| SMILES | CC1(C)OC[C@H](C2C=CC(C)(Br)C(=O)O2)O1 |
| InChI | InChI=1S/C11H15BrO4/c1-10(2)14-6-8(16-10)7-4-5-11(3,12)9(13)15-7/h4-5,7-8H,6H2,1-3H3/t7?,8-,11?/m1/s1 |
| InChIKey | PFWRPMQLSVDXHT-JKDSDDBFSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|