C33H33IrN2S- — CID 58400989
1-(1,3-dicyclohexyldibenzothiophen-4-yl)-2-phenylimidazole;iridium (PubChem CID 58400989) has the molecular formula C33H33IrN2S- and a molecular weight of 681.93 g/mol. Its IUPAC name is 1-(1,3-dicyclohexyldibenzothiophen-4-yl)-2-phenylimidazole;iridium.
| Compound Name | 1-(1,3-dicyclohexyldibenzothiophen-4-yl)-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 58400989 |
| Molecular Formula | C33H33IrN2S- |
| Molecular Weight | 681.93 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | 1-(1,3-dicyclohexyldibenzothiophen-4-yl)-2-phenylimidazole;iridium |
| SMILES | [Ir].[c-]1ccccc1-c1nccn1-c1c(C2CCCCC2)cc(C2CCCCC2)c2c1sc1ccccc12 |
| InChI | InChI=1S/C33H33N2S.Ir/c1-4-12-23(13-5-1)27-22-28(24-14-6-2-7-15-24)31(32-30(27)26-18-10-11-19-29(26)36-32)35-21-20-34-33(35)25-16-8-3-9-17-25;/h3,8-11,16,18-24H,1-2,4-7,12-15H2;/q-1; |
| InChIKey | BMZNABNVHDEWPW-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.93 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|