C32H26N4Pt — CID 58401467
bis(1-methyl-5-phenyl-4-phenylimidazole);platinum(2+) (PubChem CID 58401467) has the molecular formula C32H26N4Pt and a molecular weight of 661.67 g/mol. Its IUPAC name is bis(1-methyl-5-phenyl-4-phenylimidazole);platinum(2+).
| Compound Name | bis(1-methyl-5-phenyl-4-phenylimidazole);platinum(2+) |
|---|---|
| PubChem CID | 58401467 |
| Molecular Formula | C32H26N4Pt |
| Molecular Weight | 661.67 g/mol |
| Exact Mass | 661.18 |
| IUPAC Name | bis(1-methyl-5-phenyl-4-phenylimidazole);platinum(2+) |
| SMILES | Cn1cnc(-c2[c-]cccc2)c1-c1ccccc1.Cn1cnc(-c2[c-]cccc2)c1-c1ccccc1.[Pt+2] |
| InChI | InChI=1S/2C16H13N2.Pt/c2*1-18-12-17-15(13-8-4-2-5-9-13)16(18)14-10-6-3-7-11-14;/h2*2-8,10-12H,1H3;/q2*-1;+2 |
| InChIKey | KEKHKDCNJOCMMF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|