C24H26N4Pt — CID 58401867
bis(1,2-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole);platinum(2+) (PubChem CID 58401867) has the molecular formula C24H26N4Pt and a molecular weight of 565.58 g/mol. Its IUPAC name is bis(1,2-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole);platinum(2+).
| Compound Name | bis(1,2-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole);platinum(2+) |
|---|---|
| PubChem CID | 58401867 |
| Molecular Formula | C24H26N4Pt |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | bis(1,2-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole);platinum(2+) |
| SMILES | Cc1ccc[c-]c1-c1cn(C)c(C)n1.Cc1ccc[c-]c1-c1cn(C)c(C)n1.[Pt+2] |
| InChI | InChI=1S/2C12H13N2.Pt/c2*1-9-6-4-5-7-11(9)12-8-14(3)10(2)13-12;/h2*4-6,8H,1-3H3;/q2*-1;+2 |
| InChIKey | UVWJQGHEUMGPGE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|