About 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene
2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene (PubChem CID 45092525) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene.
Analyze 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene?
The IUPAC name of 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene (CID 45092525) is 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene.
What is the SMILES notation for 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene?
The canonical SMILES for 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene is C1=C2CC(=C1)n1cncc12.
What is the InChIKey of 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene?
The InChIKey is JQGPYTHDLQCRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-7-3-6(1)8-4-9-5-10(7)8/h1-2,4-5H,3H2.
What are the key properties of 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene?
2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene has a molecular weight of 130.15 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diazatricyclo[5.2.1.02,6]deca-1(9),3,5,7-tetraene is sourced from PubChem (CID 45092525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).