C17H26N2 — CID 14403478
1-cyclopentyl-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]imidazole (PubChem CID 14403478) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-cyclopentyl-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]imidazole.
| Compound Name | 1-cyclopentyl-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]imidazole |
|---|---|
| PubChem CID | 14403478 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-cyclopentyl-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]imidazole |
| SMILES | CC(C)=CCC/C(C)=C/c1cncn1C1CCCC1 |
| InChI | InChI=1S/C17H26N2/c1-14(2)7-6-8-15(3)11-17-12-18-13-19(17)16-9-4-5-10-16/h7,11-13,16H,4-6,8-10H2,1-3H3/b15-11+ |
| InChIKey | JUSVCNOPGYLJAI-RVDMUPIBSA-N |
| XLogP | 5.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|