C44H27B2F3N2Pt — CID 58401872
7-methyl-5-naphthalen-1-yl-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;5-naphthalen-1-yl-7-(trifluoromethyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;platinum(2+) (PubChem CID 58401872) has the molecular formula C44H27B2F3N2Pt and a molecular weight of 857.41 g/mol. Its IUPAC name is 7-methyl-5-naphthalen-1-yl-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;5-naphthalen-1-yl-7-(trifluoromethyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;platinum(2+).
| Compound Name | 7-methyl-5-naphthalen-1-yl-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;5-naphthalen-1-yl-7-(trifluoromethyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;platinum(2+) |
|---|---|
| PubChem CID | 58401872 |
| Molecular Formula | C44H27B2F3N2Pt |
| Molecular Weight | 857.41 g/mol |
| Exact Mass | 857.20 |
| IUPAC Name | 7-methyl-5-naphthalen-1-yl-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;5-naphthalen-1-yl-7-(trifluoromethyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide;platinum(2+) |
| SMILES | Cc1c[c-]c2c(c1)B(c1cccc3ccccc13)c1cccnc1-2.FC(F)(F)c1c[c-]c2c(c1)B(c1cccc3ccccc13)c1cccnc1-2.[Pt+2] |
| InChI | InChI=1S/C22H12BF3N.C22H15BN.Pt/c24-22(25,26)15-10-11-17-20(13-15)23(19-9-4-12-27-21(17)19)18-8-3-6-14-5-1-2-7-16(14)18;1-15-11-12-18-21(14-15)23(20-10-5-13-24-22(18)20)19-9-4-7-16-6-2-3-8-17(16)19;/h1-10,12-13H;2-11,13-14H,1H3;/q2*-1;+2 |
| InChIKey | CTUKIODEKPOOKR-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|