About 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol
10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol (PubChem CID 58402153) has the molecular formula C20H15N2OPt-
and a molecular weight of 494.43 g/mol. Its IUPAC name is 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol.
Molecular Properties
| Compound Name | 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol |
| PubChem CID | 58402153 |
| Molecular Formula | C20H15N2OPt- |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol |
| SMILES | C=C(O)c1ccccn1.[Pt].[c-]1cccc2ccc3cccnc3c12 |
| InChI | InChI=1S/C13H8N.C7H7NO.Pt/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;1-6(9)7-4-2-3-5-8-7;/h1-5,7-9H;2-5,9H,1H2;/q-1;; |
| InChIKey | VHSCDJQAIOBJLR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol?
The IUPAC name of 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol (CID 58402153) is 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol.
What is the SMILES notation for 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol?
The canonical SMILES for 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol is C=C(O)c1ccccn1.[Pt].[c-]1cccc2ccc3cccnc3c12.
What is the InChIKey of 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol?
The InChIKey is VHSCDJQAIOBJLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N.C7H7NO.Pt/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;1-6(9)7-4-2-3-5-8-7;/h1-5,7-9H;2-5,9H,1H2;/q-1;;.
What are the key properties of 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol?
10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol has a molecular weight of 494.43 g/mol, XLogP of 4.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-benzo[h]quinolin-10-ide;platinum;1-pyridin-2-ylethenol is sourced from PubChem (CID 58402153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).