C28H30N2O — CID 58408214
N-[(1S,3aS,6aR)-4-[(3-phenylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-methylpyridine-3-carboxamide (PubChem CID 58408214) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[(1S,3aS,6aR)-4-[(3-phenylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-[(1S,3aS,6aR)-4-[(3-phenylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 58408214 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-[(1S,3aS,6aR)-4-[(3-phenylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-5-methylpyridine-3-carboxamide |
| SMILES | Cc1cncc(C(=O)N[C@H]2CC[C@H]3C(Cc4cccc(-c5ccccc5)c4)CC[C@@H]23)c1 |
| InChI | InChI=1S/C28H30N2O/c1-19-14-24(18-29-17-19)28(31)30-27-13-12-25-23(10-11-26(25)27)16-20-6-5-9-22(15-20)21-7-3-2-4-8-21/h2-9,14-15,17-18,23,25-27H,10-13,16H2,1H3,(H,30,31)/t23?,25-,26+,27-/m0/s1 |
| InChIKey | CACMVZQIOLGZMC-UBSKWHBCSA-N |
| XLogP | 5.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |