C34H40S2Si2 — CID 58410896
triethyl-(18-triethylsilyl-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl)silane (PubChem CID 58410896) has the molecular formula C34H40S2Si2 and a molecular weight of 569.00 g/mol. Its IUPAC name is triethyl-(18-triethylsilyl-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl)silane.
| Compound Name | triethyl-(18-triethylsilyl-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl)silane |
|---|---|
| PubChem CID | 58410896 |
| Molecular Formula | C34H40S2Si2 |
| Molecular Weight | 569.00 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | triethyl-(18-triethylsilyl-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl)silane |
| SMILES | CC[Si](CC)(CC)c1cc2cc3ccc4c5cc6sc([Si](CC)(CC)CC)cc6cc5ccc4c3cc2s1 |
| InChI | InChI=1S/C34H40S2Si2/c1-7-37(8-2,9-3)33-19-25-17-23-13-15-28-27(29(23)21-31(25)35-33)16-14-24-18-26-20-34(36-32(26)22-30(24)28)38(10-4,11-5)12-6/h13-22H,7-12H2,1-6H3 |
| InChIKey | UZIIOQMSQDQWHY-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.00 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|