C27H35N3O2S — CID 58415994
tert-butyl N-ethyl-N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohexyl]carbamate (PubChem CID 58415994) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58415994 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | tert-butyl N-ethyl-N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohexyl]carbamate |
| SMILES | [H]/N=C(/Cc1ccc2[nH]cc(C3CCC(N(CC)C(=O)OC(C)(C)C)CC3)c2c1)c1cccs1 |
| InChI | InChI=1S/C27H35N3O2S/c1-5-30(26(31)32-27(2,3)4)20-11-9-19(10-12-20)22-17-29-24-13-8-18(15-21(22)24)16-23(28)25-7-6-14-33-25/h6-8,13-15,17,19-20,28-29H,5,9-12,16H2,1-4H3/b28-23- |
| InChIKey | VZJQDRXVCPJRKJ-NFFVHWSESA-N |
| XLogP | 7.12 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|