C16H19N3O3 — CID 58417448
N-[1-[4-(hydroxycarbamoyl)-2-methylphenyl]ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 58417448) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[1-[4-(hydroxycarbamoyl)-2-methylphenyl]ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[1-[4-(hydroxycarbamoyl)-2-methylphenyl]ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 58417448 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[1-[4-(hydroxycarbamoyl)-2-methylphenyl]ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1cc(C(=O)NO)ccc1C(C)NC(=O)c1cccn1C |
| InChI | InChI=1S/C16H19N3O3/c1-10-9-12(15(20)18-22)6-7-13(10)11(2)17-16(21)14-5-4-8-19(14)3/h4-9,11,22H,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | BGZNTHRAELMPLK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|