C26H24N4O4 — CID 58417893
pyridin-3-yl 4-(5-phenylmethoxy-1H-indole-2-carbonyl)piperazine-1-carboxylate (PubChem CID 58417893) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is pyridin-3-yl 4-(5-phenylmethoxy-1H-indole-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | pyridin-3-yl 4-(5-phenylmethoxy-1H-indole-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58417893 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | pyridin-3-yl 4-(5-phenylmethoxy-1H-indole-2-carbonyl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1cccnc1)N1CCN(C(=O)c2cc3cc(OCc4ccccc4)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C26H24N4O4/c31-25(29-11-13-30(14-12-29)26(32)34-22-7-4-10-27-17-22)24-16-20-15-21(8-9-23(20)28-24)33-18-19-5-2-1-3-6-19/h1-10,15-17,28H,11-14,18H2 |
| InChIKey | XXWVVTRAEGXULR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |