C18H19N5O3 — CID 143986416
molecular hydrogen;pyridin-3-yl 4-(1H-benzimidazole-2-carbonyl)piperazine-1-carboxylate (PubChem CID 143986416) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is molecular hydrogen;pyridin-3-yl 4-(1H-benzimidazole-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | molecular hydrogen;pyridin-3-yl 4-(1H-benzimidazole-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143986416 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | molecular hydrogen;pyridin-3-yl 4-(1H-benzimidazole-2-carbonyl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1cccnc1)N1CCN(C(=O)c2nc3ccccc3[nH]2)CC1.[H][H] |
| InChI | InChI=1S/C18H17N5O3.H2/c24-17(16-20-14-5-1-2-6-15(14)21-16)22-8-10-23(11-9-22)18(25)26-13-4-3-7-19-12-13;/h1-7,12H,8-11H2,(H,20,21);1H |
| InChIKey | BYTVCVBIWCADHO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |