C19H16ClN3O3S — CID 58417846
pyridin-3-yl 4-(6-chloro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate (PubChem CID 58417846) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is pyridin-3-yl 4-(6-chloro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | pyridin-3-yl 4-(6-chloro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58417846 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | pyridin-3-yl 4-(6-chloro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1cccnc1)N1CCN(C(=O)c2cc3ccc(Cl)cc3s2)CC1 |
| InChI | InChI=1S/C19H16ClN3O3S/c20-14-4-3-13-10-17(27-16(13)11-14)18(24)22-6-8-23(9-7-22)19(25)26-15-2-1-5-21-12-15/h1-5,10-12H,6-9H2 |
| InChIKey | WOVBHNBQKXZPCO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |