C23H24N2O3S — CID 58418268
5-[(1S)-2,2-dimethyl-1-[(4-phenylbenzoyl)amino]propyl]-N-hydroxythiophene-3-carboxamide (PubChem CID 58418268) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 5-[(1S)-2,2-dimethyl-1-[(4-phenylbenzoyl)amino]propyl]-N-hydroxythiophene-3-carboxamide.
| Compound Name | 5-[(1S)-2,2-dimethyl-1-[(4-phenylbenzoyl)amino]propyl]-N-hydroxythiophene-3-carboxamide |
|---|---|
| PubChem CID | 58418268 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 5-[(1S)-2,2-dimethyl-1-[(4-phenylbenzoyl)amino]propyl]-N-hydroxythiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)c1cc(C(=O)NO)cs1 |
| InChI | InChI=1S/C23H24N2O3S/c1-23(2,3)20(19-13-18(14-29-19)22(27)25-28)24-21(26)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-14,20,28H,1-3H3,(H,24,26)(H,25,27)/t20-/m1/s1 |
| InChIKey | UZTPHPIMDBIICR-HXUWFJFHSA-N |
| XLogP | 5.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|