C14H23N3O3S — CID 58418278
5-[(1S)-1-[[2-(dimethylamino)acetyl]amino]-2,2-dimethylpropyl]-N-hydroxythiophene-3-carboxamide (PubChem CID 58418278) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-[(1S)-1-[[2-(dimethylamino)acetyl]amino]-2,2-dimethylpropyl]-N-hydroxythiophene-3-carboxamide.
| Compound Name | 5-[(1S)-1-[[2-(dimethylamino)acetyl]amino]-2,2-dimethylpropyl]-N-hydroxythiophene-3-carboxamide |
|---|---|
| PubChem CID | 58418278 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-[(1S)-1-[[2-(dimethylamino)acetyl]amino]-2,2-dimethylpropyl]-N-hydroxythiophene-3-carboxamide |
| SMILES | CN(C)CC(=O)N[C@H](c1cc(C(=O)NO)cs1)C(C)(C)C |
| InChI | InChI=1S/C14H23N3O3S/c1-14(2,3)12(15-11(18)7-17(4)5)10-6-9(8-21-10)13(19)16-20/h6,8,12,20H,7H2,1-5H3,(H,15,18)(H,16,19)/t12-/m1/s1 |
| InChIKey | OTJYKPREPDQLJM-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|