C36H70N2 — CID 58420835
(10E)-9-[(E)-non-3-enyl]-10-[(E)-non-3-enylidene]octadecane-1,18-diamine (PubChem CID 58420835) has the molecular formula C36H70N2 and a molecular weight of 530.97 g/mol. Its IUPAC name is (10E)-9-[(E)-non-3-enyl]-10-[(E)-non-3-enylidene]octadecane-1,18-diamine.
| Compound Name | (10E)-9-[(E)-non-3-enyl]-10-[(E)-non-3-enylidene]octadecane-1,18-diamine |
|---|---|
| PubChem CID | 58420835 |
| Molecular Formula | C36H70N2 |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 530.55 |
| IUPAC Name | (10E)-9-[(E)-non-3-enyl]-10-[(E)-non-3-enylidene]octadecane-1,18-diamine |
| SMILES | CCCCC/C=C/C/C=C(\CCCCCCCCN)C(CC/C=C/CCCCC)CCCCCCCCN |
| InChI | InChI=1S/C36H70N2/c1-3-5-7-9-11-17-23-29-35(31-25-19-13-15-21-27-33-37)36(30-24-18-12-10-8-6-4-2)32-26-20-14-16-22-28-34-38/h11-12,17-18,29,36H,3-10,13-16,19-28,30-34,37-38H2,1-2H3/b17-11+,18-12+,35-29+ |
| InChIKey | BFEIRSLTXYCIQV-RFNFWEJMSA-N |
| XLogP | 11.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|