C15H17BrO2 — CID 58424743
6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one (PubChem CID 58424743) has the molecular formula C15H17BrO2 and a molecular weight of 309.20 g/mol. Its IUPAC name is 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one.
| Compound Name | 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 58424743 |
| Molecular Formula | C15H17BrO2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one |
| SMILES | CCC1CCC2(CC(=O)c3cc(Br)ccc3O2)C1 |
| InChI | InChI=1S/C15H17BrO2/c1-2-10-5-6-15(8-10)9-13(17)12-7-11(16)3-4-14(12)18-15/h3-4,7,10H,2,5-6,8-9H2,1H3 |
| InChIKey | ORJVMGPKMZOMHN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |