About 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one
6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one (PubChem CID 58424743) has the molecular formula C15H17BrO2
and a molecular weight of 309.20 g/mol. Its IUPAC name is 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one.
Molecular Properties
| Compound Name | 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one |
| PubChem CID | 58424743 |
| Molecular Formula | C15H17BrO2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one |
| SMILES | CCC1CCC2(CC(=O)c3cc(Br)ccc3O2)C1 |
| InChI | InChI=1S/C15H17BrO2/c1-2-10-5-6-15(8-10)9-13(17)12-7-11(16)3-4-14(12)18-15/h3-4,7,10H,2,5-6,8-9H2,1H3 |
| InChIKey | ORJVMGPKMZOMHN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one?
The IUPAC name of 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one (CID 58424743) is 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one.
What is the SMILES notation for 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one?
The canonical SMILES for 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one is CCC1CCC2(CC(=O)c3cc(Br)ccc3O2)C1.
What is the InChIKey of 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one?
The InChIKey is ORJVMGPKMZOMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrO2/c1-2-10-5-6-15(8-10)9-13(17)12-7-11(16)3-4-14(12)18-15/h3-4,7,10H,2,5-6,8-9H2,1H3.
What are the key properties of 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one?
6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one has a molecular weight of 309.20 g/mol, XLogP of 4.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one is sourced from PubChem (CID 58424743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).