C16H19BrO3 — CID 114674156
6-bromo-2'-propylspiro[3H-chromene-2,4'-oxane]-4-one (PubChem CID 114674156) has the molecular formula C16H19BrO3 and a molecular weight of 339.23 g/mol. Its IUPAC name is 6-bromo-2'-propylspiro[3H-chromene-2,4'-oxane]-4-one.
| Compound Name | 6-bromo-2'-propylspiro[3H-chromene-2,4'-oxane]-4-one |
|---|---|
| PubChem CID | 114674156 |
| Molecular Formula | C16H19BrO3 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 6-bromo-2'-propylspiro[3H-chromene-2,4'-oxane]-4-one |
| SMILES | CCCC1CC2(CCO1)CC(=O)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C16H19BrO3/c1-2-3-12-9-16(6-7-19-12)10-14(18)13-8-11(17)4-5-15(13)20-16/h4-5,8,12H,2-3,6-7,9-10H2,1H3 |
| InChIKey | LVRAYVAPROUPTR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |