About N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine
N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine (PubChem CID 114712323) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine.
Molecular Properties
| Compound Name | N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine |
| PubChem CID | 114712323 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine |
| SMILES | CCCC1CC2(CCO1)CC(NCC)c1ccccc1O2 |
| InChI | InChI=1S/C18H27NO2/c1-3-7-14-12-18(10-11-20-14)13-16(19-4-2)15-8-5-6-9-17(15)21-18/h5-6,8-9,14,16,19H,3-4,7,10-13H2,1-2H3 |
| InChIKey | VFUYAERHYPORLY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
The IUPAC name of N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine (CID 114712323) is N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine.
What is the SMILES notation for N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
The canonical SMILES for N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine is CCCC1CC2(CCO1)CC(NCC)c1ccccc1O2.
What is the InChIKey of N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
The InChIKey is VFUYAERHYPORLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2/c1-3-7-14-12-18(10-11-20-14)13-16(19-4-2)15-8-5-6-9-17(15)21-18/h5-6,8-9,14,16,19H,3-4,7,10-13H2,1-2H3.
What are the key properties of N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine has a molecular weight of 289.42 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine is sourced from PubChem (CID 114712323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).