About N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine
N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine (PubChem CID 114712062) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine.
Molecular Properties
| Compound Name | N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine |
| PubChem CID | 114712062 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine |
| SMILES | CNC1CC2(CCOC(C(C)C)C2)Oc2ccccc21 |
| InChI | InChI=1S/C17H25NO2/c1-12(2)16-11-17(8-9-19-16)10-14(18-3)13-6-4-5-7-15(13)20-17/h4-7,12,14,16,18H,8-11H2,1-3H3 |
| InChIKey | ITFNDQZHKNLXCN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
The IUPAC name of N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine (CID 114712062) is N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine.
What is the SMILES notation for N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
The canonical SMILES for N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine is CNC1CC2(CCOC(C(C)C)C2)Oc2ccccc21.
What is the InChIKey of N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
The InChIKey is ITFNDQZHKNLXCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-12(2)16-11-17(8-9-19-16)10-14(18-3)13-6-4-5-7-15(13)20-17/h4-7,12,14,16,18H,8-11H2,1-3H3.
What are the key properties of N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine?
N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine has a molecular weight of 275.39 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-amine is sourced from PubChem (CID 114712062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).