C16H19FO3 — CID 114672109
6-fluoro-2'-propan-2-ylspiro[3H-chromene-2,4'-oxane]-4-one (PubChem CID 114672109) has the molecular formula C16H19FO3 and a molecular weight of 278.32 g/mol. Its IUPAC name is 6-fluoro-2'-propan-2-ylspiro[3H-chromene-2,4'-oxane]-4-one.
| Compound Name | 6-fluoro-2'-propan-2-ylspiro[3H-chromene-2,4'-oxane]-4-one |
|---|---|
| PubChem CID | 114672109 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 6-fluoro-2'-propan-2-ylspiro[3H-chromene-2,4'-oxane]-4-one |
| SMILES | CC(C)C1CC2(CCO1)CC(=O)c1cc(F)ccc1O2 |
| InChI | InChI=1S/C16H19FO3/c1-10(2)15-9-16(5-6-19-15)8-13(18)12-7-11(17)3-4-14(12)20-16/h3-4,7,10,15H,5-6,8-9H2,1-2H3 |
| InChIKey | JEYYNYQZNIRYHF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |