About 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one
6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one (PubChem CID 106825069) has the molecular formula C13H13FO3
and a molecular weight of 236.24 g/mol. Its IUPAC name is 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one.
Molecular Properties
| Compound Name | 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one |
| PubChem CID | 106825069 |
| Molecular Formula | C13H13FO3 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one |
| SMILES | COC1CC2(CC(=O)c3cc(F)ccc3O2)C1 |
| InChI | InChI=1S/C13H13FO3/c1-16-9-5-13(6-9)7-11(15)10-4-8(14)2-3-12(10)17-13/h2-4,9H,5-7H2,1H3 |
| InChIKey | JRZKVRBTXXRGGU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one?
The IUPAC name of 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one (CID 106825069) is 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one.
What is the SMILES notation for 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one?
The canonical SMILES for 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one is COC1CC2(CC(=O)c3cc(F)ccc3O2)C1.
What is the InChIKey of 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one?
The InChIKey is JRZKVRBTXXRGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO3/c1-16-9-5-13(6-9)7-11(15)10-4-8(14)2-3-12(10)17-13/h2-4,9H,5-7H2,1H3.
What are the key properties of 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one?
6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one has a molecular weight of 236.24 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3'-methoxyspiro[3H-chromene-2,1'-cyclobutane]-4-one is sourced from PubChem (CID 106825069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).