C19H21ClN2O4 — CID 58424857
ethyl 3-[4-[(2-chloropyridine-3-carbonyl)-(methoxymethyl)amino]phenyl]propanoate (PubChem CID 58424857) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is ethyl 3-[4-[(2-chloropyridine-3-carbonyl)-(methoxymethyl)amino]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[(2-chloropyridine-3-carbonyl)-(methoxymethyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 58424857 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | ethyl 3-[4-[(2-chloropyridine-3-carbonyl)-(methoxymethyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(N(COC)C(=O)c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-3-26-17(23)11-8-14-6-9-15(10-7-14)22(13-25-2)19(24)16-5-4-12-21-18(16)20/h4-7,9-10,12H,3,8,11,13H2,1-2H3 |
| InChIKey | XUCYQKLCCZBHPB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|