C21H42N6O6 — CID 58425894
N'-[2-[2-[[3-(5-aminopentylamino)-3-oxopropanoyl]amino]ethyl-(2,3-dihydroxypropyl)amino]ethyl]-N-propylpropanediamide (PubChem CID 58425894) has the molecular formula C21H42N6O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is N'-[2-[2-[[3-(5-aminopentylamino)-3-oxopropanoyl]amino]ethyl-(2,3-dihydroxypropyl)amino]ethyl]-N-propylpropanediamide.
| Compound Name | N'-[2-[2-[[3-(5-aminopentylamino)-3-oxopropanoyl]amino]ethyl-(2,3-dihydroxypropyl)amino]ethyl]-N-propylpropanediamide |
|---|---|
| PubChem CID | 58425894 |
| Molecular Formula | C21H42N6O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | N'-[2-[2-[[3-(5-aminopentylamino)-3-oxopropanoyl]amino]ethyl-(2,3-dihydroxypropyl)amino]ethyl]-N-propylpropanediamide |
| SMILES | CCCNC(=O)CC(=O)NCCN(CCNC(=O)CC(=O)NCCCCCN)CC(O)CO |
| InChI | InChI=1S/C21H42N6O6/c1-2-7-23-18(30)13-20(32)25-9-11-27(15-17(29)16-28)12-10-26-21(33)14-19(31)24-8-5-3-4-6-22/h17,28-29H,2-16,22H2,1H3,(H,23,30)(H,24,31)(H,25,32)(H,26,33) |
| InChIKey | KMMKVLJABACGCE-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|