C23H52B2N8O4 — CID 59846978
CID 59846978 (PubChem CID 59846978) has the molecular formula C23H52B2N8O4 and a molecular weight of 526.35 g/mol.
| Compound Name | CID 59846978 |
|---|---|
| PubChem CID | 59846978 |
| Molecular Formula | C23H52B2N8O4 |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.43 |
| IUPAC Name | — |
| SMILES | C[B]CC(O)CN(CCNCCNCCNC(=O)CC(=O)NCCNCCNCCN)CC(O)C[B]C |
| InChI | InChI=1S/C23H52B2N8O4/c1-24-16-20(34)18-33(19-21(35)17-25-2)14-13-30-8-7-29-10-12-32-23(37)15-22(36)31-11-9-28-6-5-27-4-3-26/h20-21,27-30,34-35H,3-19,26H2,1-2H3,(H,31,36)(H,32,37) |
| InChIKey | VOMLPYCRZNOVCQ-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|