C13H31N5O — CID 58426265
2-[2-[3-methyl-5-[2-(propylamino)ethyl]-1,3,5-triazinan-1-yl]ethylamino]ethanol (PubChem CID 58426265) has the molecular formula C13H31N5O and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-[2-[3-methyl-5-[2-(propylamino)ethyl]-1,3,5-triazinan-1-yl]ethylamino]ethanol.
| Compound Name | 2-[2-[3-methyl-5-[2-(propylamino)ethyl]-1,3,5-triazinan-1-yl]ethylamino]ethanol |
|---|---|
| PubChem CID | 58426265 |
| Molecular Formula | C13H31N5O |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-[2-[3-methyl-5-[2-(propylamino)ethyl]-1,3,5-triazinan-1-yl]ethylamino]ethanol |
| SMILES | CCCNCCN1CN(C)CN(CCNCCO)C1 |
| InChI | InChI=1S/C13H31N5O/c1-3-4-14-5-8-17-11-16(2)12-18(13-17)9-6-15-7-10-19/h14-15,19H,3-13H2,1-2H3 |
| InChIKey | VXNHXOWASHIFLL-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 54.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|