C16H25N — CID 58427769
3-[(3aR)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalen-2-yl]propanenitrile (PubChem CID 58427769) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 3-[(3aR)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalen-2-yl]propanenitrile.
| Compound Name | 3-[(3aR)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalen-2-yl]propanenitrile |
|---|---|
| PubChem CID | 58427769 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3-[(3aR)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalen-2-yl]propanenitrile |
| SMILES | N#CCCC1CC2CCCC3CCC[C@H](C1)C32 |
| InChI | InChI=1S/C16H25N/c17-9-3-4-12-10-14-7-1-5-13-6-2-8-15(11-12)16(13)14/h12-16H,1-8,10-11H2/t12?,13?,14-,15?,16?/m1/s1 |
| InChIKey | AFOUIGCCYOVUEU-GMOYYMRRSA-N |
| XLogP | 4.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |