C28H29F3N6O5 — CID 58428705
2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone (PubChem CID 58428705) has the molecular formula C28H29F3N6O5 and a molecular weight of 586.57 g/mol. Its IUPAC name is 2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone.
| Compound Name | 2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 58428705 |
| Molecular Formula | C28H29F3N6O5 |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone |
| SMILES | O=C(Cc1ccc(N2CCN(C(=O)Cc3ccccc3[N+](=O)[O-])CC2)nc1)c1oc(N2CCCCC2)nc1C(F)(F)F |
| InChI | InChI=1S/C28H29F3N6O5/c29-28(30,31)26-25(42-27(33-26)36-10-4-1-5-11-36)22(38)16-19-8-9-23(32-18-19)34-12-14-35(15-13-34)24(39)17-20-6-2-3-7-21(20)37(40)41/h2-3,6-9,18H,1,4-5,10-17H2 |
| InChIKey | DOPMNHJUJZRWCC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|