C16H16BCl2FO — CID 58429947
[4-[(3,5-dichlorophenyl)methoxymethyl]-2-fluorophenyl]-dimethylborane (PubChem CID 58429947) has the molecular formula C16H16BCl2FO and a molecular weight of 325.02 g/mol. Its IUPAC name is [4-[(3,5-dichlorophenyl)methoxymethyl]-2-fluorophenyl]-dimethylborane.
| Compound Name | [4-[(3,5-dichlorophenyl)methoxymethyl]-2-fluorophenyl]-dimethylborane |
|---|---|
| PubChem CID | 58429947 |
| Molecular Formula | C16H16BCl2FO |
| Molecular Weight | 325.02 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | [4-[(3,5-dichlorophenyl)methoxymethyl]-2-fluorophenyl]-dimethylborane |
| SMILES | CB(C)c1ccc(COCc2cc(Cl)cc(Cl)c2)cc1F |
| InChI | InChI=1S/C16H16BCl2FO/c1-17(2)15-4-3-11(7-16(15)20)9-21-10-12-5-13(18)8-14(19)6-12/h3-8H,9-10H2,1-2H3 |
| InChIKey | FUBPUYQQZMBHCO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.02 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|