C28H26N2O2S — CID 58431652
2-[6-(4-hydroxy-4-phenylpiperidin-1-yl)-3-pyridinyl]-1-(4-phenylthiophen-2-yl)ethanone (PubChem CID 58431652) has the molecular formula C28H26N2O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-[6-(4-hydroxy-4-phenylpiperidin-1-yl)-3-pyridinyl]-1-(4-phenylthiophen-2-yl)ethanone.
| Compound Name | 2-[6-(4-hydroxy-4-phenylpiperidin-1-yl)-3-pyridinyl]-1-(4-phenylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 58431652 |
| Molecular Formula | C28H26N2O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[6-(4-hydroxy-4-phenylpiperidin-1-yl)-3-pyridinyl]-1-(4-phenylthiophen-2-yl)ethanone |
| SMILES | O=C(Cc1ccc(N2CCC(O)(c3ccccc3)CC2)nc1)c1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C28H26N2O2S/c31-25(26-18-23(20-33-26)22-7-3-1-4-8-22)17-21-11-12-27(29-19-21)30-15-13-28(32,14-16-30)24-9-5-2-6-10-24/h1-12,18-20,32H,13-17H2 |
| InChIKey | VXIKJZXDBKGSBZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |