C18H22N2O — CID 58433101
1-[2-(4-butyl-3H-pyrrol-2-yl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 58433101) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[2-(4-butyl-3H-pyrrol-2-yl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[2-(4-butyl-3H-pyrrol-2-yl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 58433101 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[2-(4-butyl-3H-pyrrol-2-yl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CCCCC1=CN=C(C2Cc3ccccc3N2C(C)=O)C1 |
| InChI | InChI=1S/C18H22N2O/c1-3-4-7-14-10-16(19-12-14)18-11-15-8-5-6-9-17(15)20(18)13(2)21/h5-6,8-9,12,18H,3-4,7,10-11H2,1-2H3 |
| InChIKey | QDCYGEVBKXDYPB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |