C16H15ClFNO — CID 58433982
2-[5-chloro-2-(2-fluorophenyl)phenyl]-N,N-dimethylacetamide (PubChem CID 58433982) has the molecular formula C16H15ClFNO and a molecular weight of 291.75 g/mol. Its IUPAC name is 2-[5-chloro-2-(2-fluorophenyl)phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[5-chloro-2-(2-fluorophenyl)phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 58433982 |
| Molecular Formula | C16H15ClFNO |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[5-chloro-2-(2-fluorophenyl)phenyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1cc(Cl)ccc1-c1ccccc1F |
| InChI | InChI=1S/C16H15ClFNO/c1-19(2)16(20)10-11-9-12(17)7-8-13(11)14-5-3-4-6-15(14)18/h3-9H,10H2,1-2H3 |
| InChIKey | DLZBITCUXSGYOK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |