C21H17F5O4 — CID 58438686
7-[[4-(1,3-difluoropropan-2-yloxy)-3-(trifluoromethyl)phenyl]methoxy]-2H-chromene-3-carbaldehyde (PubChem CID 58438686) has the molecular formula C21H17F5O4 and a molecular weight of 428.35 g/mol. Its IUPAC name is 7-[[4-(1,3-difluoropropan-2-yloxy)-3-(trifluoromethyl)phenyl]methoxy]-2H-chromene-3-carbaldehyde.
| Compound Name | 7-[[4-(1,3-difluoropropan-2-yloxy)-3-(trifluoromethyl)phenyl]methoxy]-2H-chromene-3-carbaldehyde |
|---|---|
| PubChem CID | 58438686 |
| Molecular Formula | C21H17F5O4 |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 7-[[4-(1,3-difluoropropan-2-yloxy)-3-(trifluoromethyl)phenyl]methoxy]-2H-chromene-3-carbaldehyde |
| SMILES | O=CC1=Cc2ccc(OCc3ccc(OC(CF)CF)c(C(F)(F)F)c3)cc2OC1 |
| InChI | InChI=1S/C21H17F5O4/c22-8-17(9-23)30-19-4-1-13(6-18(19)21(24,25)26)11-28-16-3-2-15-5-14(10-27)12-29-20(15)7-16/h1-7,10,17H,8-9,11-12H2 |
| InChIKey | LAGKJSIZHKQJLR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|