C20H19BrO4 — CID 58438827
7-[(3-bromo-4-propan-2-yloxyphenyl)methoxy]-2H-chromene-3-carbaldehyde (PubChem CID 58438827) has the molecular formula C20H19BrO4 and a molecular weight of 403.27 g/mol. Its IUPAC name is 7-[(3-bromo-4-propan-2-yloxyphenyl)methoxy]-2H-chromene-3-carbaldehyde.
| Compound Name | 7-[(3-bromo-4-propan-2-yloxyphenyl)methoxy]-2H-chromene-3-carbaldehyde |
|---|---|
| PubChem CID | 58438827 |
| Molecular Formula | C20H19BrO4 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 7-[(3-bromo-4-propan-2-yloxyphenyl)methoxy]-2H-chromene-3-carbaldehyde |
| SMILES | CC(C)Oc1ccc(COc2ccc3c(c2)OCC(C=O)=C3)cc1Br |
| InChI | InChI=1S/C20H19BrO4/c1-13(2)25-19-6-3-14(8-18(19)21)11-23-17-5-4-16-7-15(10-22)12-24-20(16)9-17/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | LLJQBMIYOFWRFB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|