C20H12F3N3O2 — CID 58439222
6-pyridin-3-yloxy-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-4-one (PubChem CID 58439222) has the molecular formula C20H12F3N3O2 and a molecular weight of 383.33 g/mol. Its IUPAC name is 6-pyridin-3-yloxy-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-4-one.
| Compound Name | 6-pyridin-3-yloxy-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 58439222 |
| Molecular Formula | C20H12F3N3O2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 6-pyridin-3-yloxy-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-4-one |
| SMILES | O=c1ncn(Cc2c(F)cc(F)cc2F)c2ccc(Oc3cccnc3)cc12 |
| InChI | InChI=1S/C20H12F3N3O2/c21-12-6-17(22)16(18(23)7-12)10-26-11-25-20(27)15-8-13(3-4-19(15)26)28-14-2-1-5-24-9-14/h1-9,11H,10H2 |
| InChIKey | JISSRKVCYCWMNL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |