C20H18F3N3O2 — CID 71712749
1-(cyclopentylmethyl)-6-[[3-(trifluoromethyl)-2-pyridinyl]oxy]quinazolin-4-one (PubChem CID 71712749) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-6-[[3-(trifluoromethyl)-2-pyridinyl]oxy]quinazolin-4-one.
| Compound Name | 1-(cyclopentylmethyl)-6-[[3-(trifluoromethyl)-2-pyridinyl]oxy]quinazolin-4-one |
|---|---|
| PubChem CID | 71712749 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-(cyclopentylmethyl)-6-[[3-(trifluoromethyl)-2-pyridinyl]oxy]quinazolin-4-one |
| SMILES | O=c1ncn(CC2CCCC2)c2ccc(Oc3ncccc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C20H18F3N3O2/c21-20(22,23)16-6-3-9-24-19(16)28-14-7-8-17-15(10-14)18(27)25-12-26(17)11-13-4-1-2-5-13/h3,6-10,12-13H,1-2,4-5,11H2 |
| InChIKey | XBJWDYDPARFEQB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |