C27H31F2N5O4S — CID 58440554
2-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-1-[4-(dimethylamino)-2-(oxan-4-ylamino)phenyl]ethanone (PubChem CID 58440554) has the molecular formula C27H31F2N5O4S and a molecular weight of 559.64 g/mol. Its IUPAC name is 2-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-1-[4-(dimethylamino)-2-(oxan-4-ylamino)phenyl]ethanone.
| Compound Name | 2-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-1-[4-(dimethylamino)-2-(oxan-4-ylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 58440554 |
| Molecular Formula | C27H31F2N5O4S |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 2-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-1-[4-(dimethylamino)-2-(oxan-4-ylamino)phenyl]ethanone |
| SMILES | CN(C)c1ccc(C(=O)Cc2n[nH]c3c2CN(S(=O)(=O)c2cc(F)cc(F)c2)CC3)c(NC2CCOCC2)c1 |
| InChI | InChI=1S/C27H31F2N5O4S/c1-33(2)20-3-4-22(25(14-20)30-19-6-9-38-10-7-19)27(35)15-26-23-16-34(8-5-24(23)31-32-26)39(36,37)21-12-17(28)11-18(29)13-21/h3-4,11-14,19,30H,5-10,15-16H2,1-2H3,(H,31,32) |
| InChIKey | KPQBYJMYTMHCEQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |